C21H41BO3 — CID 138971827
(1R,2S,6R,9S)-2,6-dimethyl-9-propan-2-yl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclodecan-1-ol (PubChem CID 138971827) has the molecular formula C21H41BO3 and a molecular weight of 352.37 g/mol. Its IUPAC name is (1R,2S,6R,9S)-2,6-dimethyl-9-propan-2-yl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclodecan-1-ol.
| Compound Name | (1R,2S,6R,9S)-2,6-dimethyl-9-propan-2-yl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclodecan-1-ol |
|---|---|
| PubChem CID | 138971827 |
| Molecular Formula | C21H41BO3 |
| Molecular Weight | 352.37 g/mol |
| Exact Mass | 352.31 |
| IUPAC Name | (1R,2S,6R,9S)-2,6-dimethyl-9-propan-2-yl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclodecan-1-ol |
| SMILES | CC(C)[C@H]1CC[C@@H](C)C(B2OC(C)(C)C(C)(C)O2)CC[C@H](C)[C@H](O)C1 |
| InChI | InChI=1S/C21H41BO3/c1-14(2)17-11-9-15(3)18(12-10-16(4)19(23)13-17)22-24-20(5,6)21(7,8)25-22/h14-19,23H,9-13H2,1-8H3/t15-,16+,17+,18?,19-/m1/s1 |
| InChIKey | UEEQPTRRFNMEIP-OLIPCNCSSA-N |
| XLogP | 5.32 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.37 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|