C20H37BO3 — CID 101472056
(R)-[(1R,2S)-2-butyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopropyl]-cyclohexylmethanol (PubChem CID 101472056) has the molecular formula C20H37BO3 and a molecular weight of 336.32 g/mol. Its IUPAC name is (R)-[(1R,2S)-2-butyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopropyl]-cyclohexylmethanol.
| Compound Name | (R)-[(1R,2S)-2-butyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopropyl]-cyclohexylmethanol |
|---|---|
| PubChem CID | 101472056 |
| Molecular Formula | C20H37BO3 |
| Molecular Weight | 336.32 g/mol |
| Exact Mass | 336.28 |
| IUPAC Name | (R)-[(1R,2S)-2-butyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopropyl]-cyclohexylmethanol |
| SMILES | CCCC[C@H]1C[C@@]1(B1OC(C)(C)C(C)(C)O1)[C@H](O)C1CCCCC1 |
| InChI | InChI=1S/C20H37BO3/c1-6-7-13-16-14-20(16,17(22)15-11-9-8-10-12-15)21-23-18(2,3)19(4,5)24-21/h15-17,22H,6-14H2,1-5H3/t16-,17+,20-/m0/s1 |
| InChIKey | KLQAYUVIYMDKHT-QKLQHJQFSA-N |
| XLogP | 4.97 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.32 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|