C15H29BO3 — CID 42643232
(1R)-1-[(1R,2R)-2-methyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopropyl]pentan-1-ol (PubChem CID 42643232) has the molecular formula C15H29BO3 and a molecular weight of 268.21 g/mol. Its IUPAC name is (1R)-1-[(1R,2R)-2-methyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopropyl]pentan-1-ol.
| Compound Name | (1R)-1-[(1R,2R)-2-methyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopropyl]pentan-1-ol |
|---|---|
| PubChem CID | 42643232 |
| Molecular Formula | C15H29BO3 |
| Molecular Weight | 268.21 g/mol |
| Exact Mass | 268.22 |
| IUPAC Name | (1R)-1-[(1R,2R)-2-methyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopropyl]pentan-1-ol |
| SMILES | CCCC[C@@H](O)[C@]1(B2OC(C)(C)C(C)(C)O2)C[C@H]1C |
| InChI | InChI=1S/C15H29BO3/c1-7-8-9-12(17)15(10-11(15)2)16-18-13(3,4)14(5,6)19-16/h11-12,17H,7-10H2,1-6H3/t11-,12-,15+/m1/s1 |
| InChIKey | TUGKBISLXHBJEX-JMSVASOKSA-N |
| XLogP | 3.41 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.21 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|