C17H33BO3 — CID 101472057
(1R)-1-[(1R,2S)-2-butyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopropyl]-2-methylpropan-1-ol (PubChem CID 101472057) has the molecular formula C17H33BO3 and a molecular weight of 296.26 g/mol. Its IUPAC name is (1R)-1-[(1R,2S)-2-butyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopropyl]-2-methylpropan-1-ol.
| Compound Name | (1R)-1-[(1R,2S)-2-butyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopropyl]-2-methylpropan-1-ol |
|---|---|
| PubChem CID | 101472057 |
| Molecular Formula | C17H33BO3 |
| Molecular Weight | 296.26 g/mol |
| Exact Mass | 296.25 |
| IUPAC Name | (1R)-1-[(1R,2S)-2-butyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopropyl]-2-methylpropan-1-ol |
| SMILES | CCCC[C@H]1C[C@@]1(B1OC(C)(C)C(C)(C)O1)[C@H](O)C(C)C |
| InChI | InChI=1S/C17H33BO3/c1-8-9-10-13-11-17(13,14(19)12(2)3)18-20-15(4,5)16(6,7)21-18/h12-14,19H,8-11H2,1-7H3/t13-,14+,17-/m0/s1 |
| InChIKey | CGAFEKAYWLKRIY-VBQJREDUSA-N |
| XLogP | 4.05 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.26 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|