C13H25BO3 — CID 154718790
(S)-cyclohexyl-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methanol (PubChem CID 154718790) has the molecular formula C13H25BO3 and a molecular weight of 240.15 g/mol. Its IUPAC name is (S)-cyclohexyl-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methanol.
| Compound Name | (S)-cyclohexyl-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methanol |
|---|---|
| PubChem CID | 154718790 |
| Molecular Formula | C13H25BO3 |
| Molecular Weight | 240.15 g/mol |
| Exact Mass | 240.19 |
| IUPAC Name | (S)-cyclohexyl-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methanol |
| SMILES | CC1(C)OB([C@H](O)C2CCCCC2)OC1(C)C |
| InChI | InChI=1S/C13H25BO3/c1-12(2)13(3,4)17-14(16-12)11(15)10-8-6-5-7-9-10/h10-11,15H,5-9H2,1-4H3/t11-/m1/s1 |
| InChIKey | QNAPAUXEBAVZCX-LLVKDONJSA-N |
| XLogP | 2.56 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.15 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|