C13H25BO3 — CID 135080230
(2R)-2-methyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexan-1-ol (PubChem CID 135080230) has the molecular formula C13H25BO3 and a molecular weight of 240.15 g/mol. Its IUPAC name is (2R)-2-methyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexan-1-ol.
| Compound Name | (2R)-2-methyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 135080230 |
| Molecular Formula | C13H25BO3 |
| Molecular Weight | 240.15 g/mol |
| Exact Mass | 240.19 |
| IUPAC Name | (2R)-2-methyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexan-1-ol |
| SMILES | C[C@@H]1CCCCC1(O)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C13H25BO3/c1-10-8-6-7-9-13(10,15)14-16-11(2,3)12(4,5)17-14/h10,15H,6-9H2,1-5H3/t10-,13?/m1/s1 |
| InChIKey | GUSXCQGJODTUOK-VUUHIHSGSA-N |
| XLogP | 2.56 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.15 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|