C14H27BO3 — CID 132509926
1-cyclohexyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethanol (PubChem CID 132509926) has the molecular formula C14H27BO3 and a molecular weight of 254.18 g/mol. Its IUPAC name is 1-cyclohexyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethanol.
| Compound Name | 1-cyclohexyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethanol |
|---|---|
| PubChem CID | 132509926 |
| Molecular Formula | C14H27BO3 |
| Molecular Weight | 254.18 g/mol |
| Exact Mass | 254.21 |
| IUPAC Name | 1-cyclohexyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethanol |
| SMILES | CC(O)(B1OC(C)(C)C(C)(C)O1)C1CCCCC1 |
| InChI | InChI=1S/C14H27BO3/c1-12(2)13(3,4)18-15(17-12)14(5,16)11-9-7-6-8-10-11/h11,16H,6-10H2,1-5H3 |
| InChIKey | SYEPSQJBASEETQ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.18 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|