C12H27BO5 — CID 159822068
boric acid;1-cyclohexyl-2,3-dimethylbutane-2,3-diol (PubChem CID 159822068) has the molecular formula C12H27BO5 and a molecular weight of 262.15 g/mol. Its IUPAC name is boric acid;1-cyclohexyl-2,3-dimethylbutane-2,3-diol.
| Compound Name | boric acid;1-cyclohexyl-2,3-dimethylbutane-2,3-diol |
|---|---|
| PubChem CID | 159822068 |
| Molecular Formula | C12H27BO5 |
| Molecular Weight | 262.15 g/mol |
| Exact Mass | 262.20 |
| IUPAC Name | boric acid;1-cyclohexyl-2,3-dimethylbutane-2,3-diol |
| SMILES | CC(C)(O)C(C)(O)CC1CCCCC1.OB(O)O |
| InChI | InChI=1S/C12H24O2.BH3O3/c1-11(2,13)12(3,14)9-10-7-5-4-6-8-10;2-1(3)4/h10,13-14H,4-9H2,1-3H3;2-4H |
| InChIKey | NMJBWWWMKXXFRA-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.15 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|