C21H40B2O5 — CID 154718475
(1S,2S)-1-cyclohexyl-2,3-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propan-1-ol (PubChem CID 154718475) has the molecular formula C21H40B2O5 and a molecular weight of 394.17 g/mol. Its IUPAC name is (1S,2S)-1-cyclohexyl-2,3-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propan-1-ol.
| Compound Name | (1S,2S)-1-cyclohexyl-2,3-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propan-1-ol |
|---|---|
| PubChem CID | 154718475 |
| Molecular Formula | C21H40B2O5 |
| Molecular Weight | 394.17 g/mol |
| Exact Mass | 394.31 |
| IUPAC Name | (1S,2S)-1-cyclohexyl-2,3-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propan-1-ol |
| SMILES | CC1(C)OB(C[C@H](B2OC(C)(C)C(C)(C)O2)[C@H](O)C2CCCCC2)OC1(C)C |
| InChI | InChI=1S/C21H40B2O5/c1-18(2)19(3,4)26-22(25-18)14-16(17(24)15-12-10-9-11-13-15)23-27-20(5,6)21(7,8)28-23/h15-17,24H,9-14H2,1-8H3/t16-,17+/m0/s1 |
| InChIKey | HBOIGPCDBGCWCJ-DLBZAZTESA-N |
| XLogP | 4.48 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.17 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|