C20H38B2O5 — CID 139124414
(1R,4R,5S)-2,2-dimethyl-4,5-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexan-1-ol (PubChem CID 139124414) has the molecular formula C20H38B2O5 and a molecular weight of 380.14 g/mol. Its IUPAC name is (1R,4R,5S)-2,2-dimethyl-4,5-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexan-1-ol.
| Compound Name | (1R,4R,5S)-2,2-dimethyl-4,5-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 139124414 |
| Molecular Formula | C20H38B2O5 |
| Molecular Weight | 380.14 g/mol |
| Exact Mass | 380.29 |
| IUPAC Name | (1R,4R,5S)-2,2-dimethyl-4,5-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexan-1-ol |
| SMILES | CC1(C)C[C@@H](B2OC(C)(C)C(C)(C)O2)[C@@H](B2OC(C)(C)C(C)(C)O2)C[C@H]1O |
| InChI | InChI=1S/C20H38B2O5/c1-16(2)12-14(22-26-19(7,8)20(9,10)27-22)13(11-15(16)23)21-24-17(3,4)18(5,6)25-21/h13-15,23H,11-12H2,1-10H3/t13-,14+,15+/m0/s1 |
| InChIKey | WRGVAIUJPVORIQ-RRFJBIMHSA-N |
| XLogP | 4.09 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.14 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|