C26H52B2O7 — CID 139124413
(1R,4R,5S)-2,2-dimethyl-4,5-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexan-1-ol;2,3-dimethylbutane-2,3-diol (PubChem CID 139124413) has the molecular formula C26H52B2O7 and a molecular weight of 498.32 g/mol. Its IUPAC name is (1R,4R,5S)-2,2-dimethyl-4,5-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexan-1-ol;2,3-dimethylbutane-2,3-diol.
| Compound Name | (1R,4R,5S)-2,2-dimethyl-4,5-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexan-1-ol;2,3-dimethylbutane-2,3-diol |
|---|---|
| PubChem CID | 139124413 |
| Molecular Formula | C26H52B2O7 |
| Molecular Weight | 498.32 g/mol |
| Exact Mass | 498.39 |
| IUPAC Name | (1R,4R,5S)-2,2-dimethyl-4,5-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexan-1-ol;2,3-dimethylbutane-2,3-diol |
| SMILES | CC(C)(O)C(C)(C)O.CC1(C)C[C@@H](B2OC(C)(C)C(C)(C)O2)[C@@H](B2OC(C)(C)C(C)(C)O2)C[C@H]1O |
| InChI | InChI=1S/C20H38B2O5.C6H14O2/c1-16(2)12-14(22-26-19(7,8)20(9,10)27-22)13(11-15(16)23)21-24-17(3,4)18(5,6)25-21;1-5(2,7)6(3,4)8/h13-15,23H,11-12H2,1-10H3;7-8H,1-4H3/t13-,14+,15+;/m0./s1 |
| InChIKey | REBOGNGMTJWHQG-ONAKXNSWSA-N |
| XLogP | 4.62 |
| TPSA | 97.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.32 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|