C19H36B2O5 — CID 11954731
2-[cyclohexyl-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methoxy]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 11954731) has the molecular formula C19H36B2O5 and a molecular weight of 366.12 g/mol. Its IUPAC name is 2-[cyclohexyl-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methoxy]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[cyclohexyl-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methoxy]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 11954731 |
| Molecular Formula | C19H36B2O5 |
| Molecular Weight | 366.12 g/mol |
| Exact Mass | 366.27 |
| IUPAC Name | 2-[cyclohexyl-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methoxy]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(OC(B2OC(C)(C)C(C)(C)O2)C2CCCCC2)OC1(C)C |
| InChI | InChI=1S/C19H36B2O5/c1-16(2)17(3,4)24-20(23-16)15(14-12-10-9-11-13-14)22-21-25-18(5,6)19(7,8)26-21/h14-15H,9-13H2,1-8H3 |
| InChIKey | ZQJOCLPCJNEMBW-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.12 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|