C19H36B2O5 — CID 135061494
4,4,5,5-tetramethyl-2-[(2R)-2-methyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexyl]oxy-1,3,2-dioxaborolane (PubChem CID 135061494) has the molecular formula C19H36B2O5 and a molecular weight of 366.12 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[(2R)-2-methyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexyl]oxy-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[(2R)-2-methyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexyl]oxy-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 135061494 |
| Molecular Formula | C19H36B2O5 |
| Molecular Weight | 366.12 g/mol |
| Exact Mass | 366.27 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[(2R)-2-methyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohexyl]oxy-1,3,2-dioxaborolane |
| SMILES | C[C@@H]1CCCCC1(OB1OC(C)(C)C(C)(C)O1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C19H36B2O5/c1-14-12-10-11-13-19(14,20-22-15(2,3)16(4,5)23-20)26-21-24-17(6,7)18(8,9)25-21/h14H,10-13H2,1-9H3/t14-,19?/m1/s1 |
| InChIKey | WAWZRJJPAADKJJ-MJTSIZKDSA-N |
| XLogP | 4.17 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.12 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|