C21H40B2O4 — CID 138984256
2-[(2R)-2-cyclohexyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 138984256) has the molecular formula C21H40B2O4 and a molecular weight of 378.17 g/mol. Its IUPAC name is 2-[(2R)-2-cyclohexyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[(2R)-2-cyclohexyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 138984256 |
| Molecular Formula | C21H40B2O4 |
| Molecular Weight | 378.17 g/mol |
| Exact Mass | 378.31 |
| IUPAC Name | 2-[(2R)-2-cyclohexyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | C[C@@H](C1CCCCC1)C(B1OC(C)(C)C(C)(C)O1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C21H40B2O4/c1-15(16-13-11-10-12-14-16)17(22-24-18(2,3)19(4,5)25-22)23-26-20(6,7)21(8,9)27-23/h15-17H,10-14H2,1-9H3/t15-/m0/s1 |
| InChIKey | HCAJKFNLDHJLDB-HNNXBMFYSA-N |
| XLogP | 5.30 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.17 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|