C22H40BNO2 — CID 176911819
10-cyclohexyl-10-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)decanenitrile (PubChem CID 176911819) has the molecular formula C22H40BNO2 and a molecular weight of 361.38 g/mol. Its IUPAC name is 10-cyclohexyl-10-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)decanenitrile.
| Compound Name | 10-cyclohexyl-10-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)decanenitrile |
|---|---|
| PubChem CID | 176911819 |
| Molecular Formula | C22H40BNO2 |
| Molecular Weight | 361.38 g/mol |
| Exact Mass | 361.32 |
| IUPAC Name | 10-cyclohexyl-10-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)decanenitrile |
| SMILES | CC1(C)OB(C(CCCCCCCCC#N)C2CCCCC2)OC1(C)C |
| InChI | InChI=1S/C22H40BNO2/c1-21(2)22(3,4)26-23(25-21)20(19-15-11-10-12-16-19)17-13-8-6-5-7-9-14-18-24/h19-20H,5-17H2,1-4H3 |
| InChIKey | QGTCIPFAAXSNEG-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.38 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|