3-acetyl-4-methoxybenzenesulfonyl chloride

C9H9ClO4S — CID 15579448

IUPAC3-acetyl-4-methoxybenzenesulfonyl chloride
SMILESCOc1ccc(S(=O)(=O)Cl)cc1C(C)=O
InChIInChI=1S/C9H9ClO4S/c1-6(11)8-5-7(15(10,12)13)3-4-9(8)14-2/h3-5H,1-2H3
InChIKeyPUCZRDMTYBCPFX-UHFFFAOYSA-N
MW248.69 g/mol
LogP1.83
Rot. Bonds3

About 3-acetyl-4-methoxybenzenesulfonyl chloride

3-acetyl-4-methoxybenzenesulfonyl chloride (PubChem CID 15579448) has the molecular formula C9H9ClO4S and a molecular weight of 248.69 g/mol. Its IUPAC name is 3-acetyl-4-methoxybenzenesulfonyl chloride.

Molecular Properties

Compound Name3-acetyl-4-methoxybenzenesulfonyl chloride
PubChem CID15579448
Molecular FormulaC9H9ClO4S
Molecular Weight248.69 g/mol
Exact Mass247.99
IUPAC Name3-acetyl-4-methoxybenzenesulfonyl chloride
SMILESCOc1ccc(S(=O)(=O)Cl)cc1C(C)=O
InChIInChI=1S/C9H9ClO4S/c1-6(11)8-5-7(15(10,12)13)3-4-9(8)14-2/h3-5H,1-2H3
InChIKeyPUCZRDMTYBCPFX-UHFFFAOYSA-N
XLogP1.83
TPSA60.44 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500248.69
LogP ≤ 51.83
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze 3-acetyl-4-methoxybenzenesulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-acetyl-4-methoxybenzenesulfonyl chloride?
The IUPAC name of 3-acetyl-4-methoxybenzenesulfonyl chloride (CID 15579448) is 3-acetyl-4-methoxybenzenesulfonyl chloride.
What is the SMILES notation for 3-acetyl-4-methoxybenzenesulfonyl chloride?
The canonical SMILES for 3-acetyl-4-methoxybenzenesulfonyl chloride is COc1ccc(S(=O)(=O)Cl)cc1C(C)=O.
What is the InChIKey of 3-acetyl-4-methoxybenzenesulfonyl chloride?
The InChIKey is PUCZRDMTYBCPFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9ClO4S/c1-6(11)8-5-7(15(10,12)13)3-4-9(8)14-2/h3-5H,1-2H3.
What are the key properties of 3-acetyl-4-methoxybenzenesulfonyl chloride?
3-acetyl-4-methoxybenzenesulfonyl chloride has a molecular weight of 248.69 g/mol, XLogP of 1.83, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-acetyl-4-methoxybenzenesulfonyl chloride is sourced from PubChem (CID 15579448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).