About 3-methoxypropyl 5-chlorosulfonyl-2-methoxybenzoate
3-methoxypropyl 5-chlorosulfonyl-2-methoxybenzoate (PubChem CID 65397137) has the molecular formula C12H15ClO6S
and a molecular weight of 322.77 g/mol. Its IUPAC name is 3-methoxypropyl 5-chlorosulfonyl-2-methoxybenzoate.
Molecular Properties
| Compound Name | 3-methoxypropyl 5-chlorosulfonyl-2-methoxybenzoate |
| PubChem CID | 65397137 |
| Molecular Formula | C12H15ClO6S |
| Molecular Weight | 322.77 g/mol |
| Exact Mass | 322.03 |
| IUPAC Name | 3-methoxypropyl 5-chlorosulfonyl-2-methoxybenzoate |
| SMILES | COCCCOC(=O)c1cc(S(=O)(=O)Cl)ccc1OC |
| InChI | InChI=1S/C12H15ClO6S/c1-17-6-3-7-19-12(14)10-8-9(20(13,15)16)4-5-11(10)18-2/h4-5,8H,3,6-7H2,1-2H3 |
| InChIKey | ZPXCYNVQDDVGHL-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.77 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-methoxypropyl 5-chlorosulfonyl-2-methoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxypropyl 5-chlorosulfonyl-2-methoxybenzoate?
The IUPAC name of 3-methoxypropyl 5-chlorosulfonyl-2-methoxybenzoate (CID 65397137) is 3-methoxypropyl 5-chlorosulfonyl-2-methoxybenzoate.
What is the SMILES notation for 3-methoxypropyl 5-chlorosulfonyl-2-methoxybenzoate?
The canonical SMILES for 3-methoxypropyl 5-chlorosulfonyl-2-methoxybenzoate is COCCCOC(=O)c1cc(S(=O)(=O)Cl)ccc1OC.
What is the InChIKey of 3-methoxypropyl 5-chlorosulfonyl-2-methoxybenzoate?
The InChIKey is ZPXCYNVQDDVGHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15ClO6S/c1-17-6-3-7-19-12(14)10-8-9(20(13,15)16)4-5-11(10)18-2/h4-5,8H,3,6-7H2,1-2H3.
What are the key properties of 3-methoxypropyl 5-chlorosulfonyl-2-methoxybenzoate?
3-methoxypropyl 5-chlorosulfonyl-2-methoxybenzoate has a molecular weight of 322.77 g/mol, XLogP of 1.82, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxypropyl 5-chlorosulfonyl-2-methoxybenzoate is sourced from PubChem (CID 65397137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).