C11H16O4 — CID 155797165
(2-propyl-1,3-dioxol-4-yl)methyl 2-methylprop-2-enoate (PubChem CID 155797165) has the molecular formula C11H16O4 and a molecular weight of 212.24 g/mol. Its IUPAC name is (2-propyl-1,3-dioxol-4-yl)methyl 2-methylprop-2-enoate.
| Compound Name | (2-propyl-1,3-dioxol-4-yl)methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 155797165 |
| Molecular Formula | C11H16O4 |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | (2-propyl-1,3-dioxol-4-yl)methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC1=COC(CCC)O1 |
| InChI | InChI=1S/C11H16O4/c1-4-5-10-13-6-9(15-10)7-14-11(12)8(2)3/h6,10H,2,4-5,7H2,1,3H3 |
| InChIKey | CSESHQZUDDDZQC-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|