C20H16NNaO7S — CID 155797231
sodium [4-[[4-(carboxymethoxy)phenyl]-pyridin-2-ylmethyl]phenyl] sulfate (PubChem CID 155797231) has the molecular formula C20H16NNaO7S and a molecular weight of 437.41 g/mol. Its IUPAC name is sodium [4-[[4-(carboxymethoxy)phenyl]-pyridin-2-ylmethyl]phenyl] sulfate.
| Compound Name | sodium [4-[[4-(carboxymethoxy)phenyl]-pyridin-2-ylmethyl]phenyl] sulfate |
|---|---|
| PubChem CID | 155797231 |
| Molecular Formula | C20H16NNaO7S |
| Molecular Weight | 437.41 g/mol |
| Exact Mass | 437.05 |
| IUPAC Name | sodium [4-[[4-(carboxymethoxy)phenyl]-pyridin-2-ylmethyl]phenyl] sulfate |
| SMILES | O=C(O)COc1ccc(C(c2ccc(OS(=O)(=O)[O-])cc2)c2ccccn2)cc1.[Na+] |
| InChI | InChI=1S/C20H17NO7S.Na/c22-19(23)13-27-16-8-4-14(5-9-16)20(18-3-1-2-12-21-18)15-6-10-17(11-7-15)28-29(24,25)26;/h1-12,20H,13H2,(H,22,23)(H,24,25,26);/q;+1/p-1 |
| InChIKey | BVGMKJWFYRGZTN-UHFFFAOYSA-M |
| XLogP | -0.43 |
| TPSA | 125.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.41 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|