C16H19FN6OS — CID 155798537
2-[5-(3-cyclopropyl-1,2,4-thiadiazol-5-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-5-fluoro-4-methyl-1H-pyrimidin-6-one (PubChem CID 155798537) has the molecular formula C16H19FN6OS and a molecular weight of 362.43 g/mol. Its IUPAC name is 2-[5-(3-cyclopropyl-1,2,4-thiadiazol-5-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-5-fluoro-4-methyl-1H-pyrimidin-6-one.
| Compound Name | 2-[5-(3-cyclopropyl-1,2,4-thiadiazol-5-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-5-fluoro-4-methyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 155798537 |
| Molecular Formula | C16H19FN6OS |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | 2-[5-(3-cyclopropyl-1,2,4-thiadiazol-5-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-5-fluoro-4-methyl-1H-pyrimidin-6-one |
| SMILES | Cc1nc(N2CC3CN(c4nc(C5CC5)ns4)CC3C2)[nH]c(=O)c1F |
| InChI | InChI=1S/C16H19FN6OS/c1-8-12(17)14(24)20-15(18-8)22-4-10-6-23(7-11(10)5-22)16-19-13(21-25-16)9-2-3-9/h9-11H,2-7H2,1H3,(H,18,20,24) |
| InChIKey | NWJZWPFRHIICJR-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |