C14H17FN6OS — CID 155941689
5-fluoro-4-methyl-2-[5-(3-methyl-1,2,4-thiadiazol-5-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-1H-pyrimidin-6-one (PubChem CID 155941689) has the molecular formula C14H17FN6OS and a molecular weight of 336.40 g/mol. Its IUPAC name is 5-fluoro-4-methyl-2-[5-(3-methyl-1,2,4-thiadiazol-5-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-1H-pyrimidin-6-one.
| Compound Name | 5-fluoro-4-methyl-2-[5-(3-methyl-1,2,4-thiadiazol-5-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 155941689 |
| Molecular Formula | C14H17FN6OS |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | 5-fluoro-4-methyl-2-[5-(3-methyl-1,2,4-thiadiazol-5-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-1H-pyrimidin-6-one |
| SMILES | Cc1nsc(N2CC3CN(c4nc(C)c(F)c(=O)[nH]4)CC3C2)n1 |
| InChI | InChI=1S/C14H17FN6OS/c1-7-11(15)12(22)18-13(16-7)20-3-9-5-21(6-10(9)4-20)14-17-8(2)19-23-14/h9-10H,3-6H2,1-2H3,(H,16,18,22) |
| InChIKey | LWEQBBXTBJAEPM-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |