C14H14N6O2 — CID 155798587
7-(2-methylpyrido[3,4-d]pyrimidin-4-yl)-1,3,7-triazaspiro[4.4]nonane-2,4-dione (PubChem CID 155798587) has the molecular formula C14H14N6O2 and a molecular weight of 298.31 g/mol. Its IUPAC name is 7-(2-methylpyrido[3,4-d]pyrimidin-4-yl)-1,3,7-triazaspiro[4.4]nonane-2,4-dione.
| Compound Name | 7-(2-methylpyrido[3,4-d]pyrimidin-4-yl)-1,3,7-triazaspiro[4.4]nonane-2,4-dione |
|---|---|
| PubChem CID | 155798587 |
| Molecular Formula | C14H14N6O2 |
| Molecular Weight | 298.31 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 7-(2-methylpyrido[3,4-d]pyrimidin-4-yl)-1,3,7-triazaspiro[4.4]nonane-2,4-dione |
| SMILES | Cc1nc(N2CCC3(C2)NC(=O)NC3=O)c2ccncc2n1 |
| InChI | InChI=1S/C14H14N6O2/c1-8-16-10-6-15-4-2-9(10)11(17-8)20-5-3-14(7-20)12(21)18-13(22)19-14/h2,4,6H,3,5,7H2,1H3,(H2,18,19,21,22) |
| InChIKey | KLJBSYWIKQUAHK-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 100.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.31 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|