C16H16N4O4S — CID 167980397
9-isoquinolin-5-ylsulfonyl-1,3,9-triazaspiro[4.5]decane-2,4-dione (PubChem CID 167980397) has the molecular formula C16H16N4O4S and a molecular weight of 360.40 g/mol. Its IUPAC name is 9-isoquinolin-5-ylsulfonyl-1,3,9-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 9-isoquinolin-5-ylsulfonyl-1,3,9-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 167980397 |
| Molecular Formula | C16H16N4O4S |
| Molecular Weight | 360.40 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | 9-isoquinolin-5-ylsulfonyl-1,3,9-triazaspiro[4.5]decane-2,4-dione |
| SMILES | O=C1NC(=O)C2(CCCN(S(=O)(=O)c3cccc4cnccc34)C2)N1 |
| InChI | InChI=1S/C16H16N4O4S/c21-14-16(19-15(22)18-14)6-2-8-20(10-16)25(23,24)13-4-1-3-11-9-17-7-5-12(11)13/h1,3-5,7,9H,2,6,8,10H2,(H2,18,19,21,22) |
| InChIKey | FPUJJBYBCGTRSO-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.40 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|