C19H19N5O3 — CID 155804065
ethyl 4-[(5-amino-3-anilino-1H-pyrazole-4-carbonyl)amino]benzoate (PubChem CID 155804065) has the molecular formula C19H19N5O3 and a molecular weight of 365.39 g/mol. Its IUPAC name is ethyl 4-[(5-amino-3-anilino-1H-pyrazole-4-carbonyl)amino]benzoate.
| Compound Name | ethyl 4-[(5-amino-3-anilino-1H-pyrazole-4-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 155804065 |
| Molecular Formula | C19H19N5O3 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | ethyl 4-[(5-amino-3-anilino-1H-pyrazole-4-carbonyl)amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)c2c(Nc3ccccc3)n[nH]c2N)cc1 |
| InChI | InChI=1S/C19H19N5O3/c1-2-27-19(26)12-8-10-14(11-9-12)22-18(25)15-16(20)23-24-17(15)21-13-6-4-3-5-7-13/h3-11H,2H2,1H3,(H,22,25)(H4,20,21,23,24) |
| InChIKey | FCCYVUQJVRTQQN-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 122.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |