C20H39O8P — CID 155804232
[(2R)-1-[ethoxy(hydroxy)phosphoryl]oxy-3-heptanoyloxypropan-2-yl] octanoate (PubChem CID 155804232) has the molecular formula C20H39O8P and a molecular weight of 438.50 g/mol. Its IUPAC name is [(2R)-1-[ethoxy(hydroxy)phosphoryl]oxy-3-heptanoyloxypropan-2-yl] octanoate.
| Compound Name | [(2R)-1-[ethoxy(hydroxy)phosphoryl]oxy-3-heptanoyloxypropan-2-yl] octanoate |
|---|---|
| PubChem CID | 155804232 |
| Molecular Formula | C20H39O8P |
| Molecular Weight | 438.50 g/mol |
| Exact Mass | 438.24 |
| IUPAC Name | [(2R)-1-[ethoxy(hydroxy)phosphoryl]oxy-3-heptanoyloxypropan-2-yl] octanoate |
| SMILES | CCCCCCCC(=O)O[C@H](COC(=O)CCCCCC)COP(=O)(O)OCC |
| InChI | InChI=1S/C20H39O8P/c1-4-7-9-11-13-15-20(22)28-18(17-27-29(23,24)26-6-3)16-25-19(21)14-12-10-8-5-2/h18H,4-17H2,1-3H3,(H,23,24)/t18-/m1/s1 |
| InChIKey | DEWJZYKSTLNNTR-GOSISDBHSA-N |
| XLogP | 4.93 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.50 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|