C23H45O8P — CID 167530367
[(2R)-3-[ethoxy(hydroxy)phosphoryl]oxy-2-octanoyloxypropyl] decanoate (PubChem CID 167530367) has the molecular formula C23H45O8P and a molecular weight of 480.58 g/mol. Its IUPAC name is [(2R)-3-[ethoxy(hydroxy)phosphoryl]oxy-2-octanoyloxypropyl] decanoate.
| Compound Name | [(2R)-3-[ethoxy(hydroxy)phosphoryl]oxy-2-octanoyloxypropyl] decanoate |
|---|---|
| PubChem CID | 167530367 |
| Molecular Formula | C23H45O8P |
| Molecular Weight | 480.58 g/mol |
| Exact Mass | 480.29 |
| IUPAC Name | [(2R)-3-[ethoxy(hydroxy)phosphoryl]oxy-2-octanoyloxypropyl] decanoate |
| SMILES | CCCCCCCCCC(=O)OC[C@H](COP(=O)(O)OCC)OC(=O)CCCCCCC |
| InChI | InChI=1S/C23H45O8P/c1-4-7-9-11-12-14-15-17-22(24)28-19-21(20-30-32(26,27)29-6-3)31-23(25)18-16-13-10-8-5-2/h21H,4-20H2,1-3H3,(H,26,27)/t21-/m1/s1 |
| InChIKey | LQVBDDXUVZSENR-OAQYLSRUSA-N |
| XLogP | 6.10 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.58 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|