C17H12ClNOS — CID 155807223
(2Z,4E)-2-(benzenesulfinyl)-5-(3-chlorophenyl)penta-2,4-dienenitrile (PubChem CID 155807223) has the molecular formula C17H12ClNOS and a molecular weight of 313.81 g/mol. Its IUPAC name is (2Z,4E)-2-(benzenesulfinyl)-5-(3-chlorophenyl)penta-2,4-dienenitrile.
| Compound Name | (2Z,4E)-2-(benzenesulfinyl)-5-(3-chlorophenyl)penta-2,4-dienenitrile |
|---|---|
| PubChem CID | 155807223 |
| Molecular Formula | C17H12ClNOS |
| Molecular Weight | 313.81 g/mol |
| Exact Mass | 313.03 |
| IUPAC Name | (2Z,4E)-2-(benzenesulfinyl)-5-(3-chlorophenyl)penta-2,4-dienenitrile |
| SMILES | N#C/C(=C/C=C/c1cccc(Cl)c1)S(=O)c1ccccc1 |
| InChI | InChI=1S/C17H12ClNOS/c18-15-8-4-6-14(12-15)7-5-11-17(13-19)21(20)16-9-2-1-3-10-16/h1-12H/b7-5+,17-11- |
| InChIKey | WCMYWACCHAFCPJ-UWNNVHOVSA-N |
| XLogP | 4.57 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.81 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|