C26H19ClN4O3S — CID 155807533
(NE)-N-[2-[[5-[2-(4-chlorophenyl)-6-methoxyquinolin-4-yl]-1,3,4-oxadiazol-2-yl]sulfanyl]-1-phenylethylidene]hydroxylamine (PubChem CID 155807533) has the molecular formula C26H19ClN4O3S and a molecular weight of 502.98 g/mol. Its IUPAC name is (NE)-N-[2-[[5-[2-(4-chlorophenyl)-6-methoxyquinolin-4-yl]-1,3,4-oxadiazol-2-yl]sulfanyl]-1-phenylethylidene]hydroxylamine.
| Compound Name | (NE)-N-[2-[[5-[2-(4-chlorophenyl)-6-methoxyquinolin-4-yl]-1,3,4-oxadiazol-2-yl]sulfanyl]-1-phenylethylidene]hydroxylamine |
|---|---|
| PubChem CID | 155807533 |
| Molecular Formula | C26H19ClN4O3S |
| Molecular Weight | 502.98 g/mol |
| Exact Mass | 502.09 |
| IUPAC Name | (NE)-N-[2-[[5-[2-(4-chlorophenyl)-6-methoxyquinolin-4-yl]-1,3,4-oxadiazol-2-yl]sulfanyl]-1-phenylethylidene]hydroxylamine |
| SMILES | COc1ccc2nc(-c3ccc(Cl)cc3)cc(-c3nnc(SC/C(=N/O)c4ccccc4)o3)c2c1 |
| InChI | InChI=1S/C26H19ClN4O3S/c1-33-19-11-12-22-20(13-19)21(14-23(28-22)17-7-9-18(27)10-8-17)25-29-30-26(34-25)35-15-24(31-32)16-5-3-2-4-6-16/h2-14,32H,15H2,1H3/b31-24- |
| InChIKey | SRRZRFQDCNVYQD-QLTSDVKISA-N |
| XLogP | 6.58 |
| TPSA | 93.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.98 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|