C17H14ClN3O3S — CID 155813484
(NZ)-N-[1-(4-chlorophenyl)-2-[[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]ethylidene]hydroxylamine (PubChem CID 155813484) has the molecular formula C17H14ClN3O3S and a molecular weight of 375.84 g/mol. Its IUPAC name is (NZ)-N-[1-(4-chlorophenyl)-2-[[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]ethylidene]hydroxylamine.
| Compound Name | (NZ)-N-[1-(4-chlorophenyl)-2-[[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]ethylidene]hydroxylamine |
|---|---|
| PubChem CID | 155813484 |
| Molecular Formula | C17H14ClN3O3S |
| Molecular Weight | 375.84 g/mol |
| Exact Mass | 375.04 |
| IUPAC Name | (NZ)-N-[1-(4-chlorophenyl)-2-[[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]ethylidene]hydroxylamine |
| SMILES | COc1ccc(-c2nnc(SC/C(=N\O)c3ccc(Cl)cc3)o2)cc1 |
| InChI | InChI=1S/C17H14ClN3O3S/c1-23-14-8-4-12(5-9-14)16-19-20-17(24-16)25-10-15(21-22)11-2-6-13(18)7-3-11/h2-9,22H,10H2,1H3/b21-15+ |
| InChIKey | VUUQJEPWZDSPON-RCCKNPSSSA-N |
| XLogP | 4.37 |
| TPSA | 80.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.84 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|