C36H26Cl2N6O6 — CID 155807559
5-(3-amino-6-chloroimidazo[1,2-a]pyridin-2-yl)-2-[5-(3-amino-6-chloroimidazo[1,2-a]pyridin-2-yl)-1,6,7-trihydroxy-3-methylnaphthalen-2-yl]-3-methylnaphthalene-1,6,7-triol (PubChem CID 155807559) has the molecular formula C36H26Cl2N6O6 and a molecular weight of 709.55 g/mol. Its IUPAC name is 5-(3-amino-6-chloroimidazo[1,2-a]pyridin-2-yl)-2-[5-(3-amino-6-chloroimidazo[1,2-a]pyridin-2-yl)-1,6,7-trihydroxy-3-methylnaphthalen-2-yl]-3-methylnaphthalene-1,6,7-triol.
| Compound Name | 5-(3-amino-6-chloroimidazo[1,2-a]pyridin-2-yl)-2-[5-(3-amino-6-chloroimidazo[1,2-a]pyridin-2-yl)-1,6,7-trihydroxy-3-methylnaphthalen-2-yl]-3-methylnaphthalene-1,6,7-triol |
|---|---|
| PubChem CID | 155807559 |
| Molecular Formula | C36H26Cl2N6O6 |
| Molecular Weight | 709.55 g/mol |
| Exact Mass | 708.13 |
| IUPAC Name | 5-(3-amino-6-chloroimidazo[1,2-a]pyridin-2-yl)-2-[5-(3-amino-6-chloroimidazo[1,2-a]pyridin-2-yl)-1,6,7-trihydroxy-3-methylnaphthalen-2-yl]-3-methylnaphthalene-1,6,7-triol |
| SMILES | Cc1cc2c(-c3nc4ccc(Cl)cn4c3N)c(O)c(O)cc2c(O)c1-c1c(C)cc2c(-c3nc4ccc(Cl)cn4c3N)c(O)c(O)cc2c1O |
| InChI | InChI=1S/C36H26Cl2N6O6/c1-13-7-17-19(9-21(45)33(49)27(17)29-35(39)43-11-15(37)3-5-23(43)41-29)31(47)25(13)26-14(2)8-18-20(32(26)48)10-22(46)34(50)28(18)30-36(40)44-12-16(38)4-6-24(44)42-30/h3-12,45-50H,39-40H2,1-2H3 |
| InChIKey | DZOLTEHOISPDTP-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 208.02 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 50 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.55 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|