C23H26N2O6 — CID 155808214
ethyl 13-[(3,4,5-trimethoxyphenyl)methyl]-3-oxa-4,13-diazatricyclo[8.3.0.02,6]trideca-1(10),2(6),4,11-tetraene-12-carboxylate (PubChem CID 155808214) has the molecular formula C23H26N2O6 and a molecular weight of 426.47 g/mol. Its IUPAC name is ethyl 13-[(3,4,5-trimethoxyphenyl)methyl]-3-oxa-4,13-diazatricyclo[8.3.0.02,6]trideca-1(10),2(6),4,11-tetraene-12-carboxylate.
| Compound Name | ethyl 13-[(3,4,5-trimethoxyphenyl)methyl]-3-oxa-4,13-diazatricyclo[8.3.0.02,6]trideca-1(10),2(6),4,11-tetraene-12-carboxylate |
|---|---|
| PubChem CID | 155808214 |
| Molecular Formula | C23H26N2O6 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | ethyl 13-[(3,4,5-trimethoxyphenyl)methyl]-3-oxa-4,13-diazatricyclo[8.3.0.02,6]trideca-1(10),2(6),4,11-tetraene-12-carboxylate |
| SMILES | CCOC(=O)c1cc2c(n1Cc1cc(OC)c(OC)c(OC)c1)-c1oncc1CCC2 |
| InChI | InChI=1S/C23H26N2O6/c1-5-30-23(26)17-11-15-7-6-8-16-12-24-31-21(16)20(15)25(17)13-14-9-18(27-2)22(29-4)19(10-14)28-3/h9-12H,5-8,13H2,1-4H3 |
| InChIKey | PUIFMIHPKBIRQC-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 84.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |