C18H17N3O4 — CID 155809665
ethyl N-[2-[(4-methoxyphenyl)carbamoyl]furo[2,3-b]pyridin-3-yl]methanimidate (PubChem CID 155809665) has the molecular formula C18H17N3O4 and a molecular weight of 339.35 g/mol. Its IUPAC name is ethyl N-[2-[(4-methoxyphenyl)carbamoyl]furo[2,3-b]pyridin-3-yl]methanimidate.
| Compound Name | ethyl N-[2-[(4-methoxyphenyl)carbamoyl]furo[2,3-b]pyridin-3-yl]methanimidate |
|---|---|
| PubChem CID | 155809665 |
| Molecular Formula | C18H17N3O4 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | ethyl N-[2-[(4-methoxyphenyl)carbamoyl]furo[2,3-b]pyridin-3-yl]methanimidate |
| SMILES | CCO/C=N/c1c(C(=O)Nc2ccc(OC)cc2)oc2ncccc12 |
| InChI | InChI=1S/C18H17N3O4/c1-3-24-11-20-15-14-5-4-10-19-18(14)25-16(15)17(22)21-12-6-8-13(23-2)9-7-12/h4-11H,3H2,1-2H3,(H,21,22)/b20-11+ |
| InChIKey | XETSNVRDQWJMNN-RGVLZGJSSA-N |
| XLogP | 3.79 |
| TPSA | 85.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|