C30H26F3N5O3S — CID 155810179
N-[2-[[4-[3-(3-methoxyphenyl)-1-phenylpyrazol-4-yl]-2-pyridinyl]amino]ethyl]-4-(trifluoromethyl)benzenesulfonamide (PubChem CID 155810179) has the molecular formula C30H26F3N5O3S and a molecular weight of 593.63 g/mol. Its IUPAC name is N-[2-[[4-[3-(3-methoxyphenyl)-1-phenylpyrazol-4-yl]-2-pyridinyl]amino]ethyl]-4-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[2-[[4-[3-(3-methoxyphenyl)-1-phenylpyrazol-4-yl]-2-pyridinyl]amino]ethyl]-4-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 155810179 |
| Molecular Formula | C30H26F3N5O3S |
| Molecular Weight | 593.63 g/mol |
| Exact Mass | 593.17 |
| IUPAC Name | N-[2-[[4-[3-(3-methoxyphenyl)-1-phenylpyrazol-4-yl]-2-pyridinyl]amino]ethyl]-4-(trifluoromethyl)benzenesulfonamide |
| SMILES | COc1cccc(-c2nn(-c3ccccc3)cc2-c2ccnc(NCCNS(=O)(=O)c3ccc(C(F)(F)F)cc3)c2)c1 |
| InChI | InChI=1S/C30H26F3N5O3S/c1-41-25-9-5-6-22(18-25)29-27(20-38(37-29)24-7-3-2-4-8-24)21-14-15-34-28(19-21)35-16-17-36-42(39,40)26-12-10-23(11-13-26)30(31,32)33/h2-15,18-20,36H,16-17H2,1H3,(H,34,35) |
| InChIKey | RDPBWONLHIKQFR-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.63 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|