C30H27N5O2 — CID 155810123
N-[2-[[4-[3-(3-methoxyphenyl)-1-phenylpyrazol-4-yl]-2-pyridinyl]amino]ethyl]benzamide (PubChem CID 155810123) has the molecular formula C30H27N5O2 and a molecular weight of 489.58 g/mol. Its IUPAC name is N-[2-[[4-[3-(3-methoxyphenyl)-1-phenylpyrazol-4-yl]-2-pyridinyl]amino]ethyl]benzamide.
| Compound Name | N-[2-[[4-[3-(3-methoxyphenyl)-1-phenylpyrazol-4-yl]-2-pyridinyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 155810123 |
| Molecular Formula | C30H27N5O2 |
| Molecular Weight | 489.58 g/mol |
| Exact Mass | 489.22 |
| IUPAC Name | N-[2-[[4-[3-(3-methoxyphenyl)-1-phenylpyrazol-4-yl]-2-pyridinyl]amino]ethyl]benzamide |
| SMILES | COc1cccc(-c2nn(-c3ccccc3)cc2-c2ccnc(NCCNC(=O)c3ccccc3)c2)c1 |
| InChI | InChI=1S/C30H27N5O2/c1-37-26-14-8-11-24(19-26)29-27(21-35(34-29)25-12-6-3-7-13-25)23-15-16-31-28(20-23)32-17-18-33-30(36)22-9-4-2-5-10-22/h2-16,19-21H,17-18H2,1H3,(H,31,32)(H,33,36) |
| InChIKey | YZGIZCDSLPOPCG-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.58 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|