C23H22N6O2 — CID 55647189
3-(4-methoxyphenyl)-1-phenyl-N-[2-(pyrimidin-2-ylamino)ethyl]pyrazole-4-carboxamide (PubChem CID 55647189) has the molecular formula C23H22N6O2 and a molecular weight of 414.47 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-1-phenyl-N-[2-(pyrimidin-2-ylamino)ethyl]pyrazole-4-carboxamide.
| Compound Name | 3-(4-methoxyphenyl)-1-phenyl-N-[2-(pyrimidin-2-ylamino)ethyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 55647189 |
| Molecular Formula | C23H22N6O2 |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | 3-(4-methoxyphenyl)-1-phenyl-N-[2-(pyrimidin-2-ylamino)ethyl]pyrazole-4-carboxamide |
| SMILES | COc1ccc(-c2nn(-c3ccccc3)cc2C(=O)NCCNc2ncccn2)cc1 |
| InChI | InChI=1S/C23H22N6O2/c1-31-19-10-8-17(9-11-19)21-20(16-29(28-21)18-6-3-2-4-7-18)22(30)24-14-15-27-23-25-12-5-13-26-23/h2-13,16H,14-15H2,1H3,(H,24,30)(H,25,26,27) |
| InChIKey | LFCPIKNVSYCPMF-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 93.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|