C22H25N3O2 — CID 18205735
3-(4-methoxyphenyl)-N-pentyl-1-phenylpyrazole-4-carboxamide (PubChem CID 18205735) has the molecular formula C22H25N3O2 and a molecular weight of 363.46 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-N-pentyl-1-phenylpyrazole-4-carboxamide.
| Compound Name | 3-(4-methoxyphenyl)-N-pentyl-1-phenylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 18205735 |
| Molecular Formula | C22H25N3O2 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | 3-(4-methoxyphenyl)-N-pentyl-1-phenylpyrazole-4-carboxamide |
| SMILES | CCCCCNC(=O)c1cn(-c2ccccc2)nc1-c1ccc(OC)cc1 |
| InChI | InChI=1S/C22H25N3O2/c1-3-4-8-15-23-22(26)20-16-25(18-9-6-5-7-10-18)24-21(20)17-11-13-19(27-2)14-12-17/h5-7,9-14,16H,3-4,8,15H2,1-2H3,(H,23,26) |
| InChIKey | AVKHFYHWYTXEGC-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|