C26H23N3O4 — CID 154750619
3-[[3-(4-methoxyphenyl)-1-phenylpyrazole-4-carbonyl]amino]-2-phenylpropanoic acid (PubChem CID 154750619) has the molecular formula C26H23N3O4 and a molecular weight of 441.49 g/mol. Its IUPAC name is 3-[[3-(4-methoxyphenyl)-1-phenylpyrazole-4-carbonyl]amino]-2-phenylpropanoic acid.
| Compound Name | 3-[[3-(4-methoxyphenyl)-1-phenylpyrazole-4-carbonyl]amino]-2-phenylpropanoic acid |
|---|---|
| PubChem CID | 154750619 |
| Molecular Formula | C26H23N3O4 |
| Molecular Weight | 441.49 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | 3-[[3-(4-methoxyphenyl)-1-phenylpyrazole-4-carbonyl]amino]-2-phenylpropanoic acid |
| SMILES | COc1ccc(-c2nn(-c3ccccc3)cc2C(=O)NCC(C(=O)O)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H23N3O4/c1-33-21-14-12-19(13-15-21)24-23(17-29(28-24)20-10-6-3-7-11-20)25(30)27-16-22(26(31)32)18-8-4-2-5-9-18/h2-15,17,22H,16H2,1H3,(H,27,30)(H,31,32) |
| InChIKey | POXHIHWUSRZKQD-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.49 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |