C20H15N3O6S — CID 155810758
methyl 2-hydroxy-5-[[4-hydroxy-5-(5-methoxy-2-oxoindol-3-yl)-1,3-thiazol-2-yl]amino]benzoate (PubChem CID 155810758) has the molecular formula C20H15N3O6S and a molecular weight of 425.42 g/mol. Its IUPAC name is methyl 2-hydroxy-5-[[4-hydroxy-5-(5-methoxy-2-oxoindol-3-yl)-1,3-thiazol-2-yl]amino]benzoate.
| Compound Name | methyl 2-hydroxy-5-[[4-hydroxy-5-(5-methoxy-2-oxoindol-3-yl)-1,3-thiazol-2-yl]amino]benzoate |
|---|---|
| PubChem CID | 155810758 |
| Molecular Formula | C20H15N3O6S |
| Molecular Weight | 425.42 g/mol |
| Exact Mass | 425.07 |
| IUPAC Name | methyl 2-hydroxy-5-[[4-hydroxy-5-(5-methoxy-2-oxoindol-3-yl)-1,3-thiazol-2-yl]amino]benzoate |
| SMILES | COC(=O)c1cc(Nc2nc(O)c(C3=c4cc(OC)ccc4=NC3=O)s2)ccc1O |
| InChI | InChI=1S/C20H15N3O6S/c1-28-10-4-5-13-11(8-10)15(17(25)22-13)16-18(26)23-20(30-16)21-9-3-6-14(24)12(7-9)19(27)29-2/h3-8,24,26H,1-2H3,(H,21,23) |
| InChIKey | WXCJQWVJHQCZCK-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 130.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.42 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|