C14H12BrN3O3S — CID 137004552
5-bromo-3-[4-hydroxy-2-(3-hydroxypropylamino)-1,3-thiazol-5-yl]indol-2-one (PubChem CID 137004552) has the molecular formula C14H12BrN3O3S and a molecular weight of 382.24 g/mol. Its IUPAC name is 5-bromo-3-[4-hydroxy-2-(3-hydroxypropylamino)-1,3-thiazol-5-yl]indol-2-one.
| Compound Name | 5-bromo-3-[4-hydroxy-2-(3-hydroxypropylamino)-1,3-thiazol-5-yl]indol-2-one |
|---|---|
| PubChem CID | 137004552 |
| Molecular Formula | C14H12BrN3O3S |
| Molecular Weight | 382.24 g/mol |
| Exact Mass | 380.98 |
| IUPAC Name | 5-bromo-3-[4-hydroxy-2-(3-hydroxypropylamino)-1,3-thiazol-5-yl]indol-2-one |
| SMILES | O=C1N=c2ccc(Br)cc2=C1c1sc(NCCCO)nc1O |
| InChI | InChI=1S/C14H12BrN3O3S/c15-7-2-3-9-8(6-7)10(12(20)17-9)11-13(21)18-14(22-11)16-4-1-5-19/h2-3,6,19,21H,1,4-5H2,(H,16,18) |
| InChIKey | FNBQYNBGGCIBSK-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 94.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.24 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|