C16H13BrN2O4S2 — CID 3476992
2-[5-(5-bromo-2-oxoindol-3-yl)-4-hydroxy-2-sulfanylidene-1,3-thiazol-3-yl]-3-methylbutanoic acid (PubChem CID 3476992) has the molecular formula C16H13BrN2O4S2 and a molecular weight of 441.33 g/mol. Its IUPAC name is 2-[5-(5-bromo-2-oxoindol-3-yl)-4-hydroxy-2-sulfanylidene-1,3-thiazol-3-yl]-3-methylbutanoic acid.
| Compound Name | 2-[5-(5-bromo-2-oxoindol-3-yl)-4-hydroxy-2-sulfanylidene-1,3-thiazol-3-yl]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 3476992 |
| Molecular Formula | C16H13BrN2O4S2 |
| Molecular Weight | 441.33 g/mol |
| Exact Mass | 439.95 |
| IUPAC Name | 2-[5-(5-bromo-2-oxoindol-3-yl)-4-hydroxy-2-sulfanylidene-1,3-thiazol-3-yl]-3-methylbutanoic acid |
| SMILES | CC(C)C(C(=O)O)n1c(O)c(C2=c3cc(Br)ccc3=NC2=O)sc1=S |
| InChI | InChI=1S/C16H13BrN2O4S2/c1-6(2)11(15(22)23)19-14(21)12(25-16(19)24)10-8-5-7(17)3-4-9(8)18-13(10)20/h3-6,11,21H,1-2H3,(H,22,23) |
| InChIKey | GPPNADGDOVNASR-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 91.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.33 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|