C18H16BrN3O5S2 — CID 137127644
ethyl 2-[3-[5-(5-bromo-2-oxoindol-3-yl)-4-hydroxy-2-sulfanylidene-1,3-thiazol-3-yl]propanoylamino]acetate (PubChem CID 137127644) has the molecular formula C18H16BrN3O5S2 and a molecular weight of 498.38 g/mol. Its IUPAC name is ethyl 2-[3-[5-(5-bromo-2-oxoindol-3-yl)-4-hydroxy-2-sulfanylidene-1,3-thiazol-3-yl]propanoylamino]acetate.
| Compound Name | ethyl 2-[3-[5-(5-bromo-2-oxoindol-3-yl)-4-hydroxy-2-sulfanylidene-1,3-thiazol-3-yl]propanoylamino]acetate |
|---|---|
| PubChem CID | 137127644 |
| Molecular Formula | C18H16BrN3O5S2 |
| Molecular Weight | 498.38 g/mol |
| Exact Mass | 496.97 |
| IUPAC Name | ethyl 2-[3-[5-(5-bromo-2-oxoindol-3-yl)-4-hydroxy-2-sulfanylidene-1,3-thiazol-3-yl]propanoylamino]acetate |
| SMILES | CCOC(=O)CNC(=O)CCn1c(O)c(C2=c3cc(Br)ccc3=NC2=O)sc1=S |
| InChI | InChI=1S/C18H16BrN3O5S2/c1-2-27-13(24)8-20-12(23)5-6-22-17(26)15(29-18(22)28)14-10-7-9(19)3-4-11(10)21-16(14)25/h3-4,7,26H,2,5-6,8H2,1H3,(H,20,23) |
| InChIKey | MIMIREHQKMRSNG-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 109.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.38 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|