C15H11BrN2O4S2 — CID 4142278
methyl 2-[5-(5-bromo-2-oxoindol-3-yl)-4-hydroxy-2-sulfanylidene-1,3-thiazol-3-yl]propanoate (PubChem CID 4142278) has the molecular formula C15H11BrN2O4S2 and a molecular weight of 427.30 g/mol. Its IUPAC name is methyl 2-[5-(5-bromo-2-oxoindol-3-yl)-4-hydroxy-2-sulfanylidene-1,3-thiazol-3-yl]propanoate.
| Compound Name | methyl 2-[5-(5-bromo-2-oxoindol-3-yl)-4-hydroxy-2-sulfanylidene-1,3-thiazol-3-yl]propanoate |
|---|---|
| PubChem CID | 4142278 |
| Molecular Formula | C15H11BrN2O4S2 |
| Molecular Weight | 427.30 g/mol |
| Exact Mass | 425.93 |
| IUPAC Name | methyl 2-[5-(5-bromo-2-oxoindol-3-yl)-4-hydroxy-2-sulfanylidene-1,3-thiazol-3-yl]propanoate |
| SMILES | COC(=O)C(C)n1c(O)c(C2=c3cc(Br)ccc3=NC2=O)sc1=S |
| InChI | InChI=1S/C15H11BrN2O4S2/c1-6(14(21)22-2)18-13(20)11(24-15(18)23)10-8-5-7(16)3-4-9(8)17-12(10)19/h3-6,20H,1-2H3 |
| InChIKey | QIAUACJTJTZPIB-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 80.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.30 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|