C19H20ClNO4S — CID 155810771
(3R)-3-chloro-4-(4-methylsulfanylphenyl)-1-(3,4,5-trimethoxyphenyl)azetidin-2-one (PubChem CID 155810771) has the molecular formula C19H20ClNO4S and a molecular weight of 393.89 g/mol. Its IUPAC name is (3R)-3-chloro-4-(4-methylsulfanylphenyl)-1-(3,4,5-trimethoxyphenyl)azetidin-2-one.
| Compound Name | (3R)-3-chloro-4-(4-methylsulfanylphenyl)-1-(3,4,5-trimethoxyphenyl)azetidin-2-one |
|---|---|
| PubChem CID | 155810771 |
| Molecular Formula | C19H20ClNO4S |
| Molecular Weight | 393.89 g/mol |
| Exact Mass | 393.08 |
| IUPAC Name | (3R)-3-chloro-4-(4-methylsulfanylphenyl)-1-(3,4,5-trimethoxyphenyl)azetidin-2-one |
| SMILES | COc1cc(N2C(=O)[C@H](Cl)C2c2ccc(SC)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C19H20ClNO4S/c1-23-14-9-12(10-15(24-2)18(14)25-3)21-17(16(20)19(21)22)11-5-7-13(26-4)8-6-11/h5-10,16-17H,1-4H3/t16-,17?/m1/s1 |
| InChIKey | KTBCTQSJQQXDMB-TZHYSIJRSA-N |
| XLogP | 4.13 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.89 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|