C33H49N3O2 — CID 155810779
(1R,2R,5S,8R,9R,10R,13R,14R,20R)-5-(imidazole-1-carbonyl)-1,2,14,19,19-pentamethyl-8-prop-1-en-2-yl-18-azapentacyclo[11.9.0.02,10.05,9.014,20]docosan-17-one (PubChem CID 155810779) has the molecular formula C33H49N3O2 and a molecular weight of 519.77 g/mol. Its IUPAC name is (1R,2R,5S,8R,9R,10R,13R,14R,20R)-5-(imidazole-1-carbonyl)-1,2,14,19,19-pentamethyl-8-prop-1-en-2-yl-18-azapentacyclo[11.9.0.02,10.05,9.014,20]docosan-17-one.
| Compound Name | (1R,2R,5S,8R,9R,10R,13R,14R,20R)-5-(imidazole-1-carbonyl)-1,2,14,19,19-pentamethyl-8-prop-1-en-2-yl-18-azapentacyclo[11.9.0.02,10.05,9.014,20]docosan-17-one |
|---|---|
| PubChem CID | 155810779 |
| Molecular Formula | C33H49N3O2 |
| Molecular Weight | 519.77 g/mol |
| Exact Mass | 519.38 |
| IUPAC Name | (1R,2R,5S,8R,9R,10R,13R,14R,20R)-5-(imidazole-1-carbonyl)-1,2,14,19,19-pentamethyl-8-prop-1-en-2-yl-18-azapentacyclo[11.9.0.02,10.05,9.014,20]docosan-17-one |
| SMILES | C=C(C)[C@@H]1CC[C@]2(C(=O)n3ccnc3)CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)CCC(=O)NC(C)(C)[C@@H]5CC[C@]43C)[C@@H]12 |
| InChI | InChI=1S/C33H49N3O2/c1-21(2)22-10-15-33(28(38)36-19-18-34-20-36)17-16-31(6)23(27(22)33)8-9-25-30(5)13-12-26(37)35-29(3,4)24(30)11-14-32(25,31)7/h18-20,22-25,27H,1,8-17H2,2-7H3,(H,35,37)/t22-,23+,24-,25+,27+,30-,31+,32+,33-/m0/s1 |
| InChIKey | KZZLVEAOUFEGMF-KZDAZGORSA-N |
| XLogP | 7.05 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.77 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|