C27H25N3O4 — CID 155810801
N-[(E)-(3,4-dimethoxyphenyl)methylideneamino]-6-(6-methoxynaphthalen-2-yl)-2-methylpyridine-3-carboxamide (PubChem CID 155810801) has the molecular formula C27H25N3O4 and a molecular weight of 455.51 g/mol. Its IUPAC name is N-[(E)-(3,4-dimethoxyphenyl)methylideneamino]-6-(6-methoxynaphthalen-2-yl)-2-methylpyridine-3-carboxamide.
| Compound Name | N-[(E)-(3,4-dimethoxyphenyl)methylideneamino]-6-(6-methoxynaphthalen-2-yl)-2-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 155810801 |
| Molecular Formula | C27H25N3O4 |
| Molecular Weight | 455.51 g/mol |
| Exact Mass | 455.18 |
| IUPAC Name | N-[(E)-(3,4-dimethoxyphenyl)methylideneamino]-6-(6-methoxynaphthalen-2-yl)-2-methylpyridine-3-carboxamide |
| SMILES | COc1ccc2cc(-c3ccc(C(=O)N/N=C/c4ccc(OC)c(OC)c4)c(C)n3)ccc2c1 |
| InChI | InChI=1S/C27H25N3O4/c1-17-23(27(31)30-28-16-18-5-12-25(33-3)26(13-18)34-4)10-11-24(29-17)21-7-6-20-15-22(32-2)9-8-19(20)14-21/h5-16H,1-4H3,(H,30,31)/b28-16+ |
| InChIKey | HQMNAAZKCZQDAM-LQKURTRISA-N |
| XLogP | 5.00 |
| TPSA | 82.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.51 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|