C14H11N3O2S — CID 155811314
7-methyl-4-oxo-N-phenyl-3H-thieno[3,2-d]pyrimidine-6-carboxamide (PubChem CID 155811314) has the molecular formula C14H11N3O2S and a molecular weight of 285.33 g/mol. Its IUPAC name is 7-methyl-4-oxo-N-phenyl-3H-thieno[3,2-d]pyrimidine-6-carboxamide.
| Compound Name | 7-methyl-4-oxo-N-phenyl-3H-thieno[3,2-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 155811314 |
| Molecular Formula | C14H11N3O2S |
| Molecular Weight | 285.33 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | 7-methyl-4-oxo-N-phenyl-3H-thieno[3,2-d]pyrimidine-6-carboxamide |
| SMILES | Cc1c(C(=O)Nc2ccccc2)sc2c(=O)[nH]cnc12 |
| InChI | InChI=1S/C14H11N3O2S/c1-8-10-12(13(18)16-7-15-10)20-11(8)14(19)17-9-5-3-2-4-6-9/h2-7H,1H3,(H,17,19)(H,15,16,18) |
| InChIKey | LEPTVTORYOAYOL-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.33 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |