C16H24O4 — CID 155811640
[(1R,4S,6R,8Z,12S)-4,12-dimethyl-11-oxo-13-oxabicyclo[10.1.0]tridec-8-en-6-yl] acetate (PubChem CID 155811640) has the molecular formula C16H24O4 and a molecular weight of 280.36 g/mol. Its IUPAC name is [(1R,4S,6R,8Z,12S)-4,12-dimethyl-11-oxo-13-oxabicyclo[10.1.0]tridec-8-en-6-yl] acetate.
| Compound Name | [(1R,4S,6R,8Z,12S)-4,12-dimethyl-11-oxo-13-oxabicyclo[10.1.0]tridec-8-en-6-yl] acetate |
|---|---|
| PubChem CID | 155811640 |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | [(1R,4S,6R,8Z,12S)-4,12-dimethyl-11-oxo-13-oxabicyclo[10.1.0]tridec-8-en-6-yl] acetate |
| SMILES | CC(=O)O[C@H]1C/C=C\CC(=O)[C@@]2(C)O[C@@H]2CC[C@H](C)C1 |
| InChI | InChI=1S/C16H24O4/c1-11-8-9-15-16(3,20-15)14(18)7-5-4-6-13(10-11)19-12(2)17/h4-5,11,13,15H,6-10H2,1-3H3/b5-4-/t11-,13-,15+,16+/m0/s1 |
| InChIKey | KSKGOUQLTPQLTI-XGJQEEGGSA-N |
| XLogP | 2.80 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|