C22H25N3O4S — CID 155811846
ethyl 4-amino-13-[(3,5-dimethoxyphenyl)methyl]-5-thia-3,13-diazatricyclo[8.3.0.02,6]trideca-1(10),2(6),3,11-tetraene-12-carboxylate (PubChem CID 155811846) has the molecular formula C22H25N3O4S and a molecular weight of 427.53 g/mol. Its IUPAC name is ethyl 4-amino-13-[(3,5-dimethoxyphenyl)methyl]-5-thia-3,13-diazatricyclo[8.3.0.02,6]trideca-1(10),2(6),3,11-tetraene-12-carboxylate.
| Compound Name | ethyl 4-amino-13-[(3,5-dimethoxyphenyl)methyl]-5-thia-3,13-diazatricyclo[8.3.0.02,6]trideca-1(10),2(6),3,11-tetraene-12-carboxylate |
|---|---|
| PubChem CID | 155811846 |
| Molecular Formula | C22H25N3O4S |
| Molecular Weight | 427.53 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | ethyl 4-amino-13-[(3,5-dimethoxyphenyl)methyl]-5-thia-3,13-diazatricyclo[8.3.0.02,6]trideca-1(10),2(6),3,11-tetraene-12-carboxylate |
| SMILES | CCOC(=O)c1cc2c(n1Cc1cc(OC)cc(OC)c1)-c1nc(N)sc1CCC2 |
| InChI | InChI=1S/C22H25N3O4S/c1-4-29-21(26)17-10-14-6-5-7-18-19(24-22(23)30-18)20(14)25(17)12-13-8-15(27-2)11-16(9-13)28-3/h8-11H,4-7,12H2,1-3H3,(H2,23,24) |
| InChIKey | AZXMJASSFZKFGR-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.53 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |