C25H26ClN3O3 — CID 24799321
ethyl (7E)-7-[(4-chlorophenyl)hydrazinylidene]-1-[(4-methoxyphenyl)methyl]-5,6-dihydro-4H-indole-2-carboxylate (PubChem CID 24799321) has the molecular formula C25H26ClN3O3 and a molecular weight of 451.95 g/mol. Its IUPAC name is ethyl (7E)-7-[(4-chlorophenyl)hydrazinylidene]-1-[(4-methoxyphenyl)methyl]-5,6-dihydro-4H-indole-2-carboxylate.
| Compound Name | ethyl (7E)-7-[(4-chlorophenyl)hydrazinylidene]-1-[(4-methoxyphenyl)methyl]-5,6-dihydro-4H-indole-2-carboxylate |
|---|---|
| PubChem CID | 24799321 |
| Molecular Formula | C25H26ClN3O3 |
| Molecular Weight | 451.95 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | ethyl (7E)-7-[(4-chlorophenyl)hydrazinylidene]-1-[(4-methoxyphenyl)methyl]-5,6-dihydro-4H-indole-2-carboxylate |
| SMILES | CCOC(=O)c1cc2c(n1Cc1ccc(OC)cc1)/C(=N/Nc1ccc(Cl)cc1)CCC2 |
| InChI | InChI=1S/C25H26ClN3O3/c1-3-32-25(30)23-15-18-5-4-6-22(28-27-20-11-9-19(26)10-12-20)24(18)29(23)16-17-7-13-21(31-2)14-8-17/h7-15,27H,3-6,16H2,1-2H3/b28-22+ |
| InChIKey | OQEWCVYTNNBGSN-XAYXJRQQSA-N |
| XLogP | 5.53 |
| TPSA | 64.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.95 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|