C22H35N11O2 — CID 155812807
N'-(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)-N-[4-(4-methylpiperazin-1-yl)pyrimidin-2-yl]ethane-1,2-diamine (PubChem CID 155812807) has the molecular formula C22H35N11O2 and a molecular weight of 485.60 g/mol. Its IUPAC name is N'-(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)-N-[4-(4-methylpiperazin-1-yl)pyrimidin-2-yl]ethane-1,2-diamine.
| Compound Name | N'-(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)-N-[4-(4-methylpiperazin-1-yl)pyrimidin-2-yl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 155812807 |
| Molecular Formula | C22H35N11O2 |
| Molecular Weight | 485.60 g/mol |
| Exact Mass | 485.30 |
| IUPAC Name | N'-(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)-N-[4-(4-methylpiperazin-1-yl)pyrimidin-2-yl]ethane-1,2-diamine |
| SMILES | CN1CCN(c2ccnc(NCCNc3nc(N4CCOCC4)nc(N4CCOCC4)n3)n2)CC1 |
| InChI | InChI=1S/C22H35N11O2/c1-30-6-8-31(9-7-30)18-2-3-23-19(26-18)24-4-5-25-20-27-21(32-10-14-34-15-11-32)29-22(28-20)33-12-16-35-17-13-33/h2-3H,4-17H2,1H3,(H,23,24,26)(H,25,27,28,29) |
| InChIKey | QPWHTJMVECCKER-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 119.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.60 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|